C19H24Cl3N5S — CID 121312178
N-[(1-ethylpiperidin-4-yl)methyl]-4-(4-methylsulfanylphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine (PubChem CID 121312178) has the molecular formula C19H24Cl3N5S and a molecular weight of 460.86 g/mol. Its IUPAC name is N-[(1-ethylpiperidin-4-yl)methyl]-4-(4-methylsulfanylphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine.
| Compound Name | N-[(1-ethylpiperidin-4-yl)methyl]-4-(4-methylsulfanylphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 121312178 |
| Molecular Formula | C19H24Cl3N5S |
| Molecular Weight | 460.86 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | N-[(1-ethylpiperidin-4-yl)methyl]-4-(4-methylsulfanylphenyl)-6-(trichloromethyl)-1,3,5-triazin-2-amine |
| SMILES | CCN1CCC(CNc2nc(-c3ccc(SC)cc3)nc(C(Cl)(Cl)Cl)n2)CC1 |
| InChI | InChI=1S/C19H24Cl3N5S/c1-3-27-10-8-13(9-11-27)12-23-18-25-16(24-17(26-18)19(20,21)22)14-4-6-15(28-2)7-5-14/h4-7,13H,3,8-12H2,1-2H3,(H,23,24,25,26) |
| InChIKey | KGAPNFFPBLYSKQ-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.86 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|