C17H19Cl3F3N5O — CID 121312202
2-ethyl-1-N-[4-(trichloromethyl)-6-[3-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-yl]butane-1,2-diamine (PubChem CID 121312202) has the molecular formula C17H19Cl3F3N5O and a molecular weight of 472.73 g/mol. Its IUPAC name is 2-ethyl-1-N-[4-(trichloromethyl)-6-[3-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-yl]butane-1,2-diamine.
| Compound Name | 2-ethyl-1-N-[4-(trichloromethyl)-6-[3-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-yl]butane-1,2-diamine |
|---|---|
| PubChem CID | 121312202 |
| Molecular Formula | C17H19Cl3F3N5O |
| Molecular Weight | 472.73 g/mol |
| Exact Mass | 471.06 |
| IUPAC Name | 2-ethyl-1-N-[4-(trichloromethyl)-6-[3-(trifluoromethoxy)phenyl]-1,3,5-triazin-2-yl]butane-1,2-diamine |
| SMILES | CCC(N)(CC)CNc1nc(-c2cccc(OC(F)(F)F)c2)nc(C(Cl)(Cl)Cl)n1 |
| InChI | InChI=1S/C17H19Cl3F3N5O/c1-3-15(24,4-2)9-25-14-27-12(26-13(28-14)16(18,19)20)10-6-5-7-11(8-10)29-17(21,22)23/h5-8H,3-4,9,24H2,1-2H3,(H,25,26,27,28) |
| InChIKey | IIOHWKAIAYUNLS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.73 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|