C20H17F3N6O2 — CID 121312589
N-methyl-3-[[4-[3-(2,3,4-trifluorophenoxy)azetidin-1-yl]-1,3,5-triazin-2-yl]amino]benzamide (PubChem CID 121312589) has the molecular formula C20H17F3N6O2 and a molecular weight of 430.39 g/mol. Its IUPAC name is N-methyl-3-[[4-[3-(2,3,4-trifluorophenoxy)azetidin-1-yl]-1,3,5-triazin-2-yl]amino]benzamide.
| Compound Name | N-methyl-3-[[4-[3-(2,3,4-trifluorophenoxy)azetidin-1-yl]-1,3,5-triazin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 121312589 |
| Molecular Formula | C20H17F3N6O2 |
| Molecular Weight | 430.39 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | N-methyl-3-[[4-[3-(2,3,4-trifluorophenoxy)azetidin-1-yl]-1,3,5-triazin-2-yl]amino]benzamide |
| SMILES | CNC(=O)c1cccc(Nc2ncnc(N3CC(Oc4ccc(F)c(F)c4F)C3)n2)c1 |
| InChI | InChI=1S/C20H17F3N6O2/c1-24-18(30)11-3-2-4-12(7-11)27-19-25-10-26-20(28-19)29-8-13(9-29)31-15-6-5-14(21)16(22)17(15)23/h2-7,10,13H,8-9H2,1H3,(H,24,30)(H,25,26,27,28) |
| InChIKey | FAPIQTLZZWVARZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|