C23H23F3N6O2 — CID 121312608
N-methyl-3-[[4-[6-(3,3,3-trifluoropropoxy)-3,4-dihydro-1H-isoquinolin-2-yl]-1,3,5-triazin-2-yl]amino]benzamide (PubChem CID 121312608) has the molecular formula C23H23F3N6O2 and a molecular weight of 472.47 g/mol. Its IUPAC name is N-methyl-3-[[4-[6-(3,3,3-trifluoropropoxy)-3,4-dihydro-1H-isoquinolin-2-yl]-1,3,5-triazin-2-yl]amino]benzamide.
| Compound Name | N-methyl-3-[[4-[6-(3,3,3-trifluoropropoxy)-3,4-dihydro-1H-isoquinolin-2-yl]-1,3,5-triazin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 121312608 |
| Molecular Formula | C23H23F3N6O2 |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | N-methyl-3-[[4-[6-(3,3,3-trifluoropropoxy)-3,4-dihydro-1H-isoquinolin-2-yl]-1,3,5-triazin-2-yl]amino]benzamide |
| SMILES | CNC(=O)c1cccc(Nc2ncnc(N3CCc4cc(OCCC(F)(F)F)ccc4C3)n2)c1 |
| InChI | InChI=1S/C23H23F3N6O2/c1-27-20(33)16-3-2-4-18(11-16)30-21-28-14-29-22(31-21)32-9-7-15-12-19(6-5-17(15)13-32)34-10-8-23(24,25)26/h2-6,11-12,14H,7-10,13H2,1H3,(H,27,33)(H,28,29,30,31) |
| InChIKey | RVJPBMKYGSUDAH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |