C13H16N4O6 — CID 121312930
5-methyl-1-[2-(5-methyl-2,4,6-trioxo-1,3-diazinan-1-yl)propyl]-1,3-diazinane-2,4,6-trione (PubChem CID 121312930) has the molecular formula C13H16N4O6 and a molecular weight of 324.29 g/mol. Its IUPAC name is 5-methyl-1-[2-(5-methyl-2,4,6-trioxo-1,3-diazinan-1-yl)propyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-methyl-1-[2-(5-methyl-2,4,6-trioxo-1,3-diazinan-1-yl)propyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 121312930 |
| Molecular Formula | C13H16N4O6 |
| Molecular Weight | 324.29 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 5-methyl-1-[2-(5-methyl-2,4,6-trioxo-1,3-diazinan-1-yl)propyl]-1,3-diazinane-2,4,6-trione |
| SMILES | CC1C(=O)NC(=O)N(CC(C)N2C(=O)NC(=O)C(C)C2=O)C1=O |
| InChI | InChI=1S/C13H16N4O6/c1-5(17-11(21)7(3)9(19)15-13(17)23)4-16-10(20)6(2)8(18)14-12(16)22/h5-7H,4H2,1-3H3,(H,14,18,22)(H,15,19,23) |
| InChIKey | OTAKHPPGCIULSU-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.29 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|