About 7-propyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine
7-propyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine (PubChem CID 121313092) has the molecular formula C8H14N4
and a molecular weight of 166.23 g/mol. Its IUPAC name is 7-propyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine.
Analyze 7-propyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-propyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine?
The IUPAC name of 7-propyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine (CID 121313092) is 7-propyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine.
What is the SMILES notation for 7-propyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine?
The canonical SMILES for 7-propyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine is CCCN1CCn2ncnc2C1.
What is the InChIKey of 7-propyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine?
The InChIKey is CGJVIILCWQXCNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4/c1-2-3-11-4-5-12-8(6-11)9-7-10-12/h7H,2-6H2,1H3.
What are the key properties of 7-propyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine?
7-propyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine has a molecular weight of 166.23 g/mol, XLogP of 0.50, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-propyl-6,8-dihydro-5H-[1,2,4]triazolo[1,5-a]pyrazine is sourced from PubChem (CID 121313092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).