C21H31N5O8 — CID 121313359
(3S)-4-[[(3S)-6-(carbamoylamino)-2-oxohexan-3-yl]amino]-3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-4-oxobutanoic acid (PubChem CID 121313359) has the molecular formula C21H31N5O8 and a molecular weight of 481.51 g/mol. Its IUPAC name is (3S)-4-[[(3S)-6-(carbamoylamino)-2-oxohexan-3-yl]amino]-3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-4-oxobutanoic acid.
| Compound Name | (3S)-4-[[(3S)-6-(carbamoylamino)-2-oxohexan-3-yl]amino]-3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 121313359 |
| Molecular Formula | C21H31N5O8 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | (3S)-4-[[(3S)-6-(carbamoylamino)-2-oxohexan-3-yl]amino]-3-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-4-oxobutanoic acid |
| SMILES | CC(=O)[C@H](CCCNC(N)=O)NC(=O)[C@H](CC(=O)O)NC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C21H31N5O8/c1-13(27)14(6-5-10-23-21(22)34)25-20(33)15(12-19(31)32)24-16(28)7-3-2-4-11-26-17(29)8-9-18(26)30/h8-9,14-15H,2-7,10-12H2,1H3,(H,24,28)(H,25,33)(H,31,32)(H3,22,23,34)/t14-,15-/m0/s1 |
| InChIKey | UXMLNVHDSJZBKN-GJZGRUSLSA-N |
| XLogP | -1.05 |
| TPSA | 205.07 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | -1.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|