C18H27N5O6 — CID 121313360
(2R)-N-[(3R)-6-(carbamoylamino)-2-oxohexan-3-yl]-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-methylbutanamide (PubChem CID 121313360) has the molecular formula C18H27N5O6 and a molecular weight of 409.44 g/mol. Its IUPAC name is (2R)-N-[(3R)-6-(carbamoylamino)-2-oxohexan-3-yl]-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-methylbutanamide.
| Compound Name | (2R)-N-[(3R)-6-(carbamoylamino)-2-oxohexan-3-yl]-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 121313360 |
| Molecular Formula | C18H27N5O6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | (2R)-N-[(3R)-6-(carbamoylamino)-2-oxohexan-3-yl]-2-[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-3-methylbutanamide |
| SMILES | CC(=O)[C@@H](CCCNC(N)=O)NC(=O)[C@H](NC(=O)CN1C(=O)C=CC1=O)C(C)C |
| InChI | InChI=1S/C18H27N5O6/c1-10(2)16(22-13(25)9-23-14(26)6-7-15(23)27)17(28)21-12(11(3)24)5-4-8-20-18(19)29/h6-7,10,12,16H,4-5,8-9H2,1-3H3,(H,21,28)(H,22,25)(H3,19,20,29)/t12-,16-/m1/s1 |
| InChIKey | JNKBBQSZJUCSKU-MLGOLLRUSA-N |
| XLogP | -1.43 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|