C22H35N5O8 — CID 121313364
(2S)-N-[(3S)-6-(carbamoylamino)-2-oxohexan-3-yl]-2-[[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetyl]amino]-3-methylbutanamide (PubChem CID 121313364) has the molecular formula C22H35N5O8 and a molecular weight of 497.55 g/mol. Its IUPAC name is (2S)-N-[(3S)-6-(carbamoylamino)-2-oxohexan-3-yl]-2-[[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetyl]amino]-3-methylbutanamide.
| Compound Name | (2S)-N-[(3S)-6-(carbamoylamino)-2-oxohexan-3-yl]-2-[[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetyl]amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 121313364 |
| Molecular Formula | C22H35N5O8 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | (2S)-N-[(3S)-6-(carbamoylamino)-2-oxohexan-3-yl]-2-[[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetyl]amino]-3-methylbutanamide |
| SMILES | CC(=O)[C@H](CCCNC(N)=O)NC(=O)[C@@H](NC(=O)COCCOCCN1C(=O)C=CC1=O)C(C)C |
| InChI | InChI=1S/C22H35N5O8/c1-14(2)20(21(32)25-16(15(3)28)5-4-8-24-22(23)33)26-17(29)13-35-12-11-34-10-9-27-18(30)6-7-19(27)31/h6-7,14,16,20H,4-5,8-13H2,1-3H3,(H,25,32)(H,26,29)(H3,23,24,33)/t16-,20-/m0/s1 |
| InChIKey | PHGREORGNQTHNE-JXFKEZNVSA-N |
| XLogP | -1.39 |
| TPSA | 186.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|