C16H25N — CID 121313684
(6S)-6-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-2-methylidene-4,5,6,7,8,9-hexahydro-3H-azecine (PubChem CID 121313684) has the molecular formula C16H25N and a molecular weight of 231.38 g/mol. Its IUPAC name is (6S)-6-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-2-methylidene-4,5,6,7,8,9-hexahydro-3H-azecine.
| Compound Name | (6S)-6-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-2-methylidene-4,5,6,7,8,9-hexahydro-3H-azecine |
|---|---|
| PubChem CID | 121313684 |
| Molecular Formula | C16H25N |
| Molecular Weight | 231.38 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | (6S)-6-[(1Z)-buta-1,3-dienyl]-3,5-dimethyl-2-methylidene-4,5,6,7,8,9-hexahydro-3H-azecine |
| SMILES | C=C/C=C\[C@H]1CCC/C=N\C(=C)C(C)CC1C |
| InChI | InChI=1S/C16H25N/c1-5-6-9-16-10-7-8-11-17-15(4)13(2)12-14(16)3/h5-6,9,11,13-14,16H,1,4,7-8,10,12H2,2-3H3/b9-6-,17-11-/t13?,14?,16-/m0/s1 |
| InChIKey | HMVOAPYSGOFWOW-PSKPEZNQSA-N |
| XLogP | 4.78 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.38 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|