C27H31FN4O5 — CID 121314550
(3R)-3-[7-[[2-fluoro-5-(3-morpholin-4-ylpropoxy)phenyl]methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 121314550) has the molecular formula C27H31FN4O5 and a molecular weight of 510.57 g/mol. Its IUPAC name is (3R)-3-[7-[[2-fluoro-5-(3-morpholin-4-ylpropoxy)phenyl]methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | (3R)-3-[7-[[2-fluoro-5-(3-morpholin-4-ylpropoxy)phenyl]methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 121314550 |
| Molecular Formula | C27H31FN4O5 |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.23 |
| IUPAC Name | (3R)-3-[7-[[2-fluoro-5-(3-morpholin-4-ylpropoxy)phenyl]methylamino]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CC[C@@H](N2Cc3c(NCc4cc(OCCCN5CCOCC5)ccc4F)cccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C27H31FN4O5/c28-22-6-5-19(37-12-2-9-31-10-13-36-14-11-31)15-18(22)16-29-23-4-1-3-20-21(23)17-32(27(20)35)24-7-8-25(33)30-26(24)34/h1,3-6,15,24,29H,2,7-14,16-17H2,(H,30,33,34)/t24-/m1/s1 |
| InChIKey | SZYHPVYNYZWHPO-XMMPIXPASA-N |
| XLogP | 2.30 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|