About methyl 5-[(1R)-1-[1-(2,2-difluoroethyl)piperidin-4-yl]ethyl]-4-methylthiophene-3-carboxylate
methyl 5-[(1R)-1-[1-(2,2-difluoroethyl)piperidin-4-yl]ethyl]-4-methylthiophene-3-carboxylate (PubChem CID 121314951) has the molecular formula C16H23F2NO2S
and a molecular weight of 331.43 g/mol. Its IUPAC name is methyl 5-[(1R)-1-[1-(2,2-difluoroethyl)piperidin-4-yl]ethyl]-4-methylthiophene-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[(1R)-1-[1-(2,2-difluoroethyl)piperidin-4-yl]ethyl]-4-methylthiophene-3-carboxylate |
| PubChem CID | 121314951 |
| Molecular Formula | C16H23F2NO2S |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | methyl 5-[(1R)-1-[1-(2,2-difluoroethyl)piperidin-4-yl]ethyl]-4-methylthiophene-3-carboxylate |
| SMILES | COC(=O)c1csc([C@H](C)C2CCN(CC(F)F)CC2)c1C |
| InChI | InChI=1S/C16H23F2NO2S/c1-10(12-4-6-19(7-5-12)8-14(17)18)15-11(2)13(9-22-15)16(20)21-3/h9-10,12,14H,4-8H2,1-3H3/t10-/m1/s1 |
| InChIKey | UOEACFBFORHVIQ-SNVBAGLBSA-N |
| XLogP | 3.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 5-[(1R)-1-[1-(2,2-difluoroethyl)piperidin-4-yl]ethyl]-4-methylthiophene-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[(1R)-1-[1-(2,2-difluoroethyl)piperidin-4-yl]ethyl]-4-methylthiophene-3-carboxylate?
The IUPAC name of methyl 5-[(1R)-1-[1-(2,2-difluoroethyl)piperidin-4-yl]ethyl]-4-methylthiophene-3-carboxylate (CID 121314951) is methyl 5-[(1R)-1-[1-(2,2-difluoroethyl)piperidin-4-yl]ethyl]-4-methylthiophene-3-carboxylate.
What is the SMILES notation for methyl 5-[(1R)-1-[1-(2,2-difluoroethyl)piperidin-4-yl]ethyl]-4-methylthiophene-3-carboxylate?
The canonical SMILES for methyl 5-[(1R)-1-[1-(2,2-difluoroethyl)piperidin-4-yl]ethyl]-4-methylthiophene-3-carboxylate is COC(=O)c1csc([C@H](C)C2CCN(CC(F)F)CC2)c1C.
What is the InChIKey of methyl 5-[(1R)-1-[1-(2,2-difluoroethyl)piperidin-4-yl]ethyl]-4-methylthiophene-3-carboxylate?
The InChIKey is UOEACFBFORHVIQ-SNVBAGLBSA-N. The full InChI is InChI=1S/C16H23F2NO2S/c1-10(12-4-6-19(7-5-12)8-14(17)18)15-11(2)13(9-22-15)16(20)21-3/h9-10,12,14H,4-8H2,1-3H3/t10-/m1/s1.
What are the key properties of methyl 5-[(1R)-1-[1-(2,2-difluoroethyl)piperidin-4-yl]ethyl]-4-methylthiophene-3-carboxylate?
methyl 5-[(1R)-1-[1-(2,2-difluoroethyl)piperidin-4-yl]ethyl]-4-methylthiophene-3-carboxylate has a molecular weight of 331.43 g/mol, XLogP of 3.92, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[(1R)-1-[1-(2,2-difluoroethyl)piperidin-4-yl]ethyl]-4-methylthiophene-3-carboxylate is sourced from PubChem (CID 121314951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).