About (2R,3S)-5-benzyl-2-(2,4-difluorophenyl)-5-azaspiro[2.4]heptane
(2R,3S)-5-benzyl-2-(2,4-difluorophenyl)-5-azaspiro[2.4]heptane (PubChem CID 121314970) has the molecular formula C19H19F2N
and a molecular weight of 299.36 g/mol. Its IUPAC name is (2R,3S)-5-benzyl-2-(2,4-difluorophenyl)-5-azaspiro[2.4]heptane.
Molecular Properties
| Compound Name | (2R,3S)-5-benzyl-2-(2,4-difluorophenyl)-5-azaspiro[2.4]heptane |
| PubChem CID | 121314970 |
| Molecular Formula | C19H19F2N |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | (2R,3S)-5-benzyl-2-(2,4-difluorophenyl)-5-azaspiro[2.4]heptane |
| SMILES | Fc1ccc([C@@H]2C[C@]23CCN(Cc2ccccc2)C3)c(F)c1 |
| InChI | InChI=1S/C19H19F2N/c20-15-6-7-16(18(21)10-15)17-11-19(17)8-9-22(13-19)12-14-4-2-1-3-5-14/h1-7,10,17H,8-9,11-13H2/t17-,19-/m0/s1 |
| InChIKey | UJBAQGGLYZPCMI-HKUYNNGSSA-N |
| XLogP | 4.34 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2R,3S)-5-benzyl-2-(2,4-difluorophenyl)-5-azaspiro[2.4]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-5-benzyl-2-(2,4-difluorophenyl)-5-azaspiro[2.4]heptane?
The IUPAC name of (2R,3S)-5-benzyl-2-(2,4-difluorophenyl)-5-azaspiro[2.4]heptane (CID 121314970) is (2R,3S)-5-benzyl-2-(2,4-difluorophenyl)-5-azaspiro[2.4]heptane.
What is the SMILES notation for (2R,3S)-5-benzyl-2-(2,4-difluorophenyl)-5-azaspiro[2.4]heptane?
The canonical SMILES for (2R,3S)-5-benzyl-2-(2,4-difluorophenyl)-5-azaspiro[2.4]heptane is Fc1ccc([C@@H]2C[C@]23CCN(Cc2ccccc2)C3)c(F)c1.
What is the InChIKey of (2R,3S)-5-benzyl-2-(2,4-difluorophenyl)-5-azaspiro[2.4]heptane?
The InChIKey is UJBAQGGLYZPCMI-HKUYNNGSSA-N. The full InChI is InChI=1S/C19H19F2N/c20-15-6-7-16(18(21)10-15)17-11-19(17)8-9-22(13-19)12-14-4-2-1-3-5-14/h1-7,10,17H,8-9,11-13H2/t17-,19-/m0/s1.
What are the key properties of (2R,3S)-5-benzyl-2-(2,4-difluorophenyl)-5-azaspiro[2.4]heptane?
(2R,3S)-5-benzyl-2-(2,4-difluorophenyl)-5-azaspiro[2.4]heptane has a molecular weight of 299.36 g/mol, XLogP of 4.34, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-5-benzyl-2-(2,4-difluorophenyl)-5-azaspiro[2.4]heptane is sourced from PubChem (CID 121314970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).