C25H27NO8S — CID 121315122
N-[2,3-dimethoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-4-hydroxybenzenesulfonamide (PubChem CID 121315122) has the molecular formula C25H27NO8S and a molecular weight of 501.56 g/mol. Its IUPAC name is N-[2,3-dimethoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-4-hydroxybenzenesulfonamide.
| Compound Name | N-[2,3-dimethoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-4-hydroxybenzenesulfonamide |
|---|---|
| PubChem CID | 121315122 |
| Molecular Formula | C25H27NO8S |
| Molecular Weight | 501.56 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | N-[2,3-dimethoxy-6-[(Z)-2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]-4-hydroxybenzenesulfonamide |
| SMILES | COc1cc(/C=C\c2ccc(OC)c(OC)c2NS(=O)(=O)c2ccc(O)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H27NO8S/c1-30-20-13-8-17(7-6-16-14-21(31-2)24(33-4)22(15-16)32-3)23(25(20)34-5)26-35(28,29)19-11-9-18(27)10-12-19/h6-15,26-27H,1-5H3/b7-6- |
| InChIKey | ICSSVEJIFJOURP-SREVYHEPSA-N |
| XLogP | 4.41 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.56 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|