About N'-methylhex-5-enimidamide
N'-methylhex-5-enimidamide (PubChem CID 121315413) has the molecular formula C7H14N2
and a molecular weight of 126.20 g/mol. Its IUPAC name is N'-methylhex-5-enimidamide.
Molecular Properties
| Compound Name | N'-methylhex-5-enimidamide |
| PubChem CID | 121315413 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | N'-methylhex-5-enimidamide |
| SMILES | C=CCCC/C(N)=N\C |
| InChI | InChI=1S/C7H14N2/c1-3-4-5-6-7(8)9-2/h3H,1,4-6H2,2H3,(H2,8,9) |
| InChIKey | USFINISJPKCKNX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-methylhex-5-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methylhex-5-enimidamide?
The IUPAC name of N'-methylhex-5-enimidamide (CID 121315413) is N'-methylhex-5-enimidamide.
What is the SMILES notation for N'-methylhex-5-enimidamide?
The canonical SMILES for N'-methylhex-5-enimidamide is C=CCCC/C(N)=N\C.
What is the InChIKey of N'-methylhex-5-enimidamide?
The InChIKey is USFINISJPKCKNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2/c1-3-4-5-6-7(8)9-2/h3H,1,4-6H2,2H3,(H2,8,9).
What are the key properties of N'-methylhex-5-enimidamide?
N'-methylhex-5-enimidamide has a molecular weight of 126.20 g/mol, XLogP of 1.33, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methylhex-5-enimidamide is sourced from PubChem (CID 121315413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).