C48H34N8 — CID 121315561
2-phenyl-4-[4-[1-phenyl-1-[4-(4-phenyl-6-pyridin-2-yl-1,3,5-triazin-2-yl)phenyl]ethyl]phenyl]-6-pyridin-2-yl-1,3,5-triazine (PubChem CID 121315561) has the molecular formula C48H34N8 and a molecular weight of 722.86 g/mol. Its IUPAC name is 2-phenyl-4-[4-[1-phenyl-1-[4-(4-phenyl-6-pyridin-2-yl-1,3,5-triazin-2-yl)phenyl]ethyl]phenyl]-6-pyridin-2-yl-1,3,5-triazine.
| Compound Name | 2-phenyl-4-[4-[1-phenyl-1-[4-(4-phenyl-6-pyridin-2-yl-1,3,5-triazin-2-yl)phenyl]ethyl]phenyl]-6-pyridin-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 121315561 |
| Molecular Formula | C48H34N8 |
| Molecular Weight | 722.86 g/mol |
| Exact Mass | 722.29 |
| IUPAC Name | 2-phenyl-4-[4-[1-phenyl-1-[4-(4-phenyl-6-pyridin-2-yl-1,3,5-triazin-2-yl)phenyl]ethyl]phenyl]-6-pyridin-2-yl-1,3,5-triazine |
| SMILES | CC(c1ccccc1)(c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccn3)n2)cc1)c1ccc(-c2nc(-c3ccccc3)nc(-c3ccccn3)n2)cc1 |
| InChI | InChI=1S/C48H34N8/c1-48(37-19-9-4-10-20-37,38-27-23-35(24-28-38)44-51-42(33-15-5-2-6-16-33)53-46(55-44)40-21-11-13-31-49-40)39-29-25-36(26-30-39)45-52-43(34-17-7-3-8-18-34)54-47(56-45)41-22-12-14-32-50-41/h2-32H,1H3 |
| InChIKey | LTHTZVTVABPROG-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.86 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|