C40H43N3 — CID 121316018
6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2,4-bis[2-(4-propan-2-ylphenyl)phenyl]-1,2,3,4-tetrahydro-1,3,5-triazine (PubChem CID 121316018) has the molecular formula C40H43N3 and a molecular weight of 565.81 g/mol. Its IUPAC name is 6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2,4-bis[2-(4-propan-2-ylphenyl)phenyl]-1,2,3,4-tetrahydro-1,3,5-triazine.
| Compound Name | 6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2,4-bis[2-(4-propan-2-ylphenyl)phenyl]-1,2,3,4-tetrahydro-1,3,5-triazine |
|---|---|
| PubChem CID | 121316018 |
| Molecular Formula | C40H43N3 |
| Molecular Weight | 565.81 g/mol |
| Exact Mass | 565.35 |
| IUPAC Name | 6-[(3E,5Z)-hepta-1,3,5-trien-4-yl]-2,4-bis[2-(4-propan-2-ylphenyl)phenyl]-1,2,3,4-tetrahydro-1,3,5-triazine |
| SMILES | C=C/C=C(\C=C/C)C1=NC(c2ccccc2-c2ccc(C(C)C)cc2)NC(c2ccccc2-c2ccc(C(C)C)cc2)N1 |
| InChI | InChI=1S/C40H43N3/c1-7-13-33(14-8-2)38-41-39(36-17-11-9-15-34(36)31-23-19-29(20-24-31)27(3)4)43-40(42-38)37-18-12-10-16-35(37)32-25-21-30(22-26-32)28(5)6/h7-28,39-40,43H,1H2,2-6H3,(H,41,42)/b14-8-,33-13+ |
| InChIKey | XACMWTINXAJECX-HZBNOABHSA-N |
| XLogP | 10.24 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.81 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|