C38H36F5NO5S — CID 121316547
5,8-bis(1-adamantyl)benzo[de]isoquinoline-1,3-dione;2,3,4,5,6-pentafluorobenzenesulfonic acid (PubChem CID 121316547) has the molecular formula C38H36F5NO5S and a molecular weight of 713.77 g/mol. Its IUPAC name is 5,8-bis(1-adamantyl)benzo[de]isoquinoline-1,3-dione;2,3,4,5,6-pentafluorobenzenesulfonic acid.
| Compound Name | 5,8-bis(1-adamantyl)benzo[de]isoquinoline-1,3-dione;2,3,4,5,6-pentafluorobenzenesulfonic acid |
|---|---|
| PubChem CID | 121316547 |
| Molecular Formula | C38H36F5NO5S |
| Molecular Weight | 713.77 g/mol |
| Exact Mass | 713.22 |
| IUPAC Name | 5,8-bis(1-adamantyl)benzo[de]isoquinoline-1,3-dione;2,3,4,5,6-pentafluorobenzenesulfonic acid |
| SMILES | O=C1NC(=O)c2cc(C34CC5CC(CC(C5)C3)C4)cc3cc(C45CC6CC(CC(C6)C4)C5)cc1c23.O=S(=O)(O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C32H35NO2.C6HF5O3S/c34-29-26-9-24(31-11-17-1-18(12-31)3-19(2-17)13-31)7-23-8-25(10-27(28(23)26)30(35)33-29)32-14-20-4-21(15-32)6-22(5-20)16-32;7-1-2(8)4(10)6(15(12,13)14)5(11)3(1)9/h7-10,17-22H,1-6,11-16H2,(H,33,34,35);(H,12,13,14) |
| InChIKey | HGMLJRPQIARQOV-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.77 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|