C18H5F5O4 — CID 121316610
8-(2,3,4,5,6-pentafluorophenoxy)-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione (PubChem CID 121316610) has the molecular formula C18H5F5O4 and a molecular weight of 380.22 g/mol. Its IUPAC name is 8-(2,3,4,5,6-pentafluorophenoxy)-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione.
| Compound Name | 8-(2,3,4,5,6-pentafluorophenoxy)-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
|---|---|
| PubChem CID | 121316610 |
| Molecular Formula | C18H5F5O4 |
| Molecular Weight | 380.22 g/mol |
| Exact Mass | 380.01 |
| IUPAC Name | 8-(2,3,4,5,6-pentafluorophenoxy)-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaene-2,4-dione |
| SMILES | O=C1OC(=O)c2ccc(Oc3c(F)c(F)c(F)c(F)c3F)c3cccc1c23 |
| InChI | InChI=1S/C18H5F5O4/c19-11-12(20)14(22)16(15(23)13(11)21)26-9-5-4-8-10-6(9)2-1-3-7(10)17(24)27-18(8)25/h1-5H |
| InChIKey | XHFWLBOZHFIOGG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.22 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|