About [(1R)-2-(4-tert-butyl-3,5-difluoroanilino)-1-(1-methylindazol-5-yl)-2-oxoethyl]carbamic acid
[(1R)-2-(4-tert-butyl-3,5-difluoroanilino)-1-(1-methylindazol-5-yl)-2-oxoethyl]carbamic acid (PubChem CID 121316665) has the molecular formula C21H22F2N4O3
and a molecular weight of 416.43 g/mol. Its IUPAC name is [(1R)-2-(4-tert-butyl-3,5-difluoroanilino)-1-(1-methylindazol-5-yl)-2-oxoethyl]carbamic acid.
Molecular Properties
| Compound Name | [(1R)-2-(4-tert-butyl-3,5-difluoroanilino)-1-(1-methylindazol-5-yl)-2-oxoethyl]carbamic acid |
| PubChem CID | 121316665 |
| Molecular Formula | C21H22F2N4O3 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | [(1R)-2-(4-tert-butyl-3,5-difluoroanilino)-1-(1-methylindazol-5-yl)-2-oxoethyl]carbamic acid |
| SMILES | Cn1ncc2cc([C@@H](NC(=O)O)C(=O)Nc3cc(F)c(C(C)(C)C)c(F)c3)ccc21 |
| InChI | InChI=1S/C21H22F2N4O3/c1-21(2,3)17-14(22)8-13(9-15(17)23)25-19(28)18(26-20(29)30)11-5-6-16-12(7-11)10-24-27(16)4/h5-10,18,26H,1-4H3,(H,25,28)(H,29,30)/t18-/m1/s1 |
| InChIKey | NSGYQWYKNIKJGI-GOSISDBHSA-N |
| XLogP | 4.10 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1R)-2-(4-tert-butyl-3,5-difluoroanilino)-1-(1-methylindazol-5-yl)-2-oxoethyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R)-2-(4-tert-butyl-3,5-difluoroanilino)-1-(1-methylindazol-5-yl)-2-oxoethyl]carbamic acid?
The IUPAC name of [(1R)-2-(4-tert-butyl-3,5-difluoroanilino)-1-(1-methylindazol-5-yl)-2-oxoethyl]carbamic acid (CID 121316665) is [(1R)-2-(4-tert-butyl-3,5-difluoroanilino)-1-(1-methylindazol-5-yl)-2-oxoethyl]carbamic acid.
What is the SMILES notation for [(1R)-2-(4-tert-butyl-3,5-difluoroanilino)-1-(1-methylindazol-5-yl)-2-oxoethyl]carbamic acid?
The canonical SMILES for [(1R)-2-(4-tert-butyl-3,5-difluoroanilino)-1-(1-methylindazol-5-yl)-2-oxoethyl]carbamic acid is Cn1ncc2cc([C@@H](NC(=O)O)C(=O)Nc3cc(F)c(C(C)(C)C)c(F)c3)ccc21.
What is the InChIKey of [(1R)-2-(4-tert-butyl-3,5-difluoroanilino)-1-(1-methylindazol-5-yl)-2-oxoethyl]carbamic acid?
The InChIKey is NSGYQWYKNIKJGI-GOSISDBHSA-N. The full InChI is InChI=1S/C21H22F2N4O3/c1-21(2,3)17-14(22)8-13(9-15(17)23)25-19(28)18(26-20(29)30)11-5-6-16-12(7-11)10-24-27(16)4/h5-10,18,26H,1-4H3,(H,25,28)(H,29,30)/t18-/m1/s1.
What are the key properties of [(1R)-2-(4-tert-butyl-3,5-difluoroanilino)-1-(1-methylindazol-5-yl)-2-oxoethyl]carbamic acid?
[(1R)-2-(4-tert-butyl-3,5-difluoroanilino)-1-(1-methylindazol-5-yl)-2-oxoethyl]carbamic acid has a molecular weight of 416.43 g/mol, XLogP of 4.10, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R)-2-(4-tert-butyl-3,5-difluoroanilino)-1-(1-methylindazol-5-yl)-2-oxoethyl]carbamic acid is sourced from PubChem (CID 121316665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).