C9H12N6 — CID 121317419
1-(3-azido-4,4-dimethylcyclopenten-1-yl)-1,2,4-triazole (PubChem CID 121317419) has the molecular formula C9H12N6 and a molecular weight of 204.24 g/mol. Its IUPAC name is 1-(3-azido-4,4-dimethylcyclopenten-1-yl)-1,2,4-triazole.
| Compound Name | 1-(3-azido-4,4-dimethylcyclopenten-1-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 121317419 |
| Molecular Formula | C9H12N6 |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 1-(3-azido-4,4-dimethylcyclopenten-1-yl)-1,2,4-triazole |
| SMILES | CC1(C)CC(n2cncn2)=CC1N=[N+]=[N-] |
| InChI | InChI=1S/C9H12N6/c1-9(2)4-7(3-8(9)13-14-10)15-6-11-5-12-15/h3,5-6,8H,4H2,1-2H3 |
| InChIKey | YQBYYXCDZUMWQX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 79.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|