About cis-(1S,3R)-3-[3-(2-methoxyethyl)imidazol-4-yl]cyclohexan-1-amine;dihydrochloride
cis-(1S,3R)-3-[3-(2-methoxyethyl)imidazol-4-yl]cyclohexan-1-amine;dihydrochloride (PubChem CID 121317531) has the molecular formula C12H23Cl2N3O
and a molecular weight of 296.24 g/mol. Its IUPAC name is cis-(1S,3R)-3-[3-(2-methoxyethyl)imidazol-4-yl]cyclohexan-1-amine;dihydrochloride.
Molecular Properties
| Compound Name | cis-(1S,3R)-3-[3-(2-methoxyethyl)imidazol-4-yl]cyclohexan-1-amine;dihydrochloride |
| PubChem CID | 121317531 |
| Molecular Formula | C12H23Cl2N3O |
| Molecular Weight | 296.24 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | cis-(1S,3R)-3-[3-(2-methoxyethyl)imidazol-4-yl]cyclohexan-1-amine;dihydrochloride |
| SMILES | COCCn1cncc1[C@@H]1CCC[C@H](N)C1.Cl.Cl |
| InChI | InChI=1S/C12H21N3O.2ClH/c1-16-6-5-15-9-14-8-12(15)10-3-2-4-11(13)7-10;;/h8-11H,2-7,13H2,1H3;2*1H/t10-,11+;;/m1../s1 |
| InChIKey | AJMUNARRRFSPMQ-OXPNAJOUSA-N |
| XLogP | 2.36 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cis-(1S,3R)-3-[3-(2-methoxyethyl)imidazol-4-yl]cyclohexan-1-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,3R)-3-[3-(2-methoxyethyl)imidazol-4-yl]cyclohexan-1-amine;dihydrochloride?
The IUPAC name of cis-(1S,3R)-3-[3-(2-methoxyethyl)imidazol-4-yl]cyclohexan-1-amine;dihydrochloride (CID 121317531) is cis-(1S,3R)-3-[3-(2-methoxyethyl)imidazol-4-yl]cyclohexan-1-amine;dihydrochloride.
What is the SMILES notation for cis-(1S,3R)-3-[3-(2-methoxyethyl)imidazol-4-yl]cyclohexan-1-amine;dihydrochloride?
The canonical SMILES for cis-(1S,3R)-3-[3-(2-methoxyethyl)imidazol-4-yl]cyclohexan-1-amine;dihydrochloride is COCCn1cncc1[C@@H]1CCC[C@H](N)C1.Cl.Cl.
What is the InChIKey of cis-(1S,3R)-3-[3-(2-methoxyethyl)imidazol-4-yl]cyclohexan-1-amine;dihydrochloride?
The InChIKey is AJMUNARRRFSPMQ-OXPNAJOUSA-N. The full InChI is InChI=1S/C12H21N3O.2ClH/c1-16-6-5-15-9-14-8-12(15)10-3-2-4-11(13)7-10;;/h8-11H,2-7,13H2,1H3;2*1H/t10-,11+;;/m1../s1.
What are the key properties of cis-(1S,3R)-3-[3-(2-methoxyethyl)imidazol-4-yl]cyclohexan-1-amine;dihydrochloride?
cis-(1S,3R)-3-[3-(2-methoxyethyl)imidazol-4-yl]cyclohexan-1-amine;dihydrochloride has a molecular weight of 296.24 g/mol, XLogP of 2.36, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,3R)-3-[3-(2-methoxyethyl)imidazol-4-yl]cyclohexan-1-amine;dihydrochloride is sourced from PubChem (CID 121317531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).