C10H14N6 — CID 121317634
1-(3-azido-4,4-dimethylcyclohexen-1-yl)-1,2,4-triazole (PubChem CID 121317634) has the molecular formula C10H14N6 and a molecular weight of 218.26 g/mol. Its IUPAC name is 1-(3-azido-4,4-dimethylcyclohexen-1-yl)-1,2,4-triazole.
| Compound Name | 1-(3-azido-4,4-dimethylcyclohexen-1-yl)-1,2,4-triazole |
|---|---|
| PubChem CID | 121317634 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 1-(3-azido-4,4-dimethylcyclohexen-1-yl)-1,2,4-triazole |
| SMILES | CC1(C)CCC(n2cncn2)=CC1N=[N+]=[N-] |
| InChI | InChI=1S/C10H14N6/c1-10(2)4-3-8(5-9(10)14-15-11)16-7-12-6-13-16/h5-7,9H,3-4H2,1-2H3 |
| InChIKey | YBUCSUDUIAFGHP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 79.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|