About N-(4-chlorophenyl)-5,5-difluoro-1-(3-pyridin-3-ylbenzoyl)piperidine-3-carboxamide
N-(4-chlorophenyl)-5,5-difluoro-1-(3-pyridin-3-ylbenzoyl)piperidine-3-carboxamide (PubChem CID 121317970) has the molecular formula C24H20ClF2N3O2
and a molecular weight of 455.89 g/mol. Its IUPAC name is N-(4-chlorophenyl)-5,5-difluoro-1-(3-pyridin-3-ylbenzoyl)piperidine-3-carboxamide.
Molecular Properties
| Compound Name | N-(4-chlorophenyl)-5,5-difluoro-1-(3-pyridin-3-ylbenzoyl)piperidine-3-carboxamide |
| PubChem CID | 121317970 |
| Molecular Formula | C24H20ClF2N3O2 |
| Molecular Weight | 455.89 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | N-(4-chlorophenyl)-5,5-difluoro-1-(3-pyridin-3-ylbenzoyl)piperidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)C1CN(C(=O)c2cccc(-c3cccnc3)c2)CC(F)(F)C1 |
| InChI | InChI=1S/C24H20ClF2N3O2/c25-20-6-8-21(9-7-20)29-22(31)19-12-24(26,27)15-30(14-19)23(32)17-4-1-3-16(11-17)18-5-2-10-28-13-18/h1-11,13,19H,12,14-15H2,(H,29,31) |
| InChIKey | JESDHZBAAFCVCU-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.89 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-chlorophenyl)-5,5-difluoro-1-(3-pyridin-3-ylbenzoyl)piperidine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-chlorophenyl)-5,5-difluoro-1-(3-pyridin-3-ylbenzoyl)piperidine-3-carboxamide?
The IUPAC name of N-(4-chlorophenyl)-5,5-difluoro-1-(3-pyridin-3-ylbenzoyl)piperidine-3-carboxamide (CID 121317970) is N-(4-chlorophenyl)-5,5-difluoro-1-(3-pyridin-3-ylbenzoyl)piperidine-3-carboxamide.
What is the SMILES notation for N-(4-chlorophenyl)-5,5-difluoro-1-(3-pyridin-3-ylbenzoyl)piperidine-3-carboxamide?
The canonical SMILES for N-(4-chlorophenyl)-5,5-difluoro-1-(3-pyridin-3-ylbenzoyl)piperidine-3-carboxamide is O=C(Nc1ccc(Cl)cc1)C1CN(C(=O)c2cccc(-c3cccnc3)c2)CC(F)(F)C1.
What is the InChIKey of N-(4-chlorophenyl)-5,5-difluoro-1-(3-pyridin-3-ylbenzoyl)piperidine-3-carboxamide?
The InChIKey is JESDHZBAAFCVCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20ClF2N3O2/c25-20-6-8-21(9-7-20)29-22(31)19-12-24(26,27)15-30(14-19)23(32)17-4-1-3-16(11-17)18-5-2-10-28-13-18/h1-11,13,19H,12,14-15H2,(H,29,31).
What are the key properties of N-(4-chlorophenyl)-5,5-difluoro-1-(3-pyridin-3-ylbenzoyl)piperidine-3-carboxamide?
N-(4-chlorophenyl)-5,5-difluoro-1-(3-pyridin-3-ylbenzoyl)piperidine-3-carboxamide has a molecular weight of 455.89 g/mol, XLogP of 5.14, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-chlorophenyl)-5,5-difluoro-1-(3-pyridin-3-ylbenzoyl)piperidine-3-carboxamide is sourced from PubChem (CID 121317970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).