About N-[1-(3-methoxyphenyl)ethyl]-2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carboxamide
N-[1-(3-methoxyphenyl)ethyl]-2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carboxamide (PubChem CID 121318215) has the molecular formula C19H21N3O2
and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[1-(3-methoxyphenyl)ethyl]-2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carboxamide.
Molecular Properties
| Compound Name | N-[1-(3-methoxyphenyl)ethyl]-2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carboxamide |
| PubChem CID | 121318215 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-[1-(3-methoxyphenyl)ethyl]-2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carboxamide |
| SMILES | COc1cccc(C(C)NC(=O)c2ccn3c(C)cc(C)nc23)c1 |
| InChI | InChI=1S/C19H21N3O2/c1-12-10-13(2)22-9-8-17(18(22)20-12)19(23)21-14(3)15-6-5-7-16(11-15)24-4/h5-11,14H,1-4H3,(H,21,23) |
| InChIKey | DGDJNKRLPHEHJJ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[1-(3-methoxyphenyl)ethyl]-2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(3-methoxyphenyl)ethyl]-2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carboxamide?
The IUPAC name of N-[1-(3-methoxyphenyl)ethyl]-2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carboxamide (CID 121318215) is N-[1-(3-methoxyphenyl)ethyl]-2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carboxamide.
What is the SMILES notation for N-[1-(3-methoxyphenyl)ethyl]-2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carboxamide?
The canonical SMILES for N-[1-(3-methoxyphenyl)ethyl]-2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carboxamide is COc1cccc(C(C)NC(=O)c2ccn3c(C)cc(C)nc23)c1.
What is the InChIKey of N-[1-(3-methoxyphenyl)ethyl]-2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carboxamide?
The InChIKey is DGDJNKRLPHEHJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O2/c1-12-10-13(2)22-9-8-17(18(22)20-12)19(23)21-14(3)15-6-5-7-16(11-15)24-4/h5-11,14H,1-4H3,(H,21,23).
What are the key properties of N-[1-(3-methoxyphenyl)ethyl]-2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carboxamide?
N-[1-(3-methoxyphenyl)ethyl]-2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carboxamide has a molecular weight of 323.40 g/mol, XLogP of 3.45, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(3-methoxyphenyl)ethyl]-2,4-dimethylpyrrolo[1,2-a]pyrimidine-8-carboxamide is sourced from PubChem (CID 121318215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).