C22H25N3O — CID 121318306
2,4-dimethyl-N-[1-(5,6,7,8-tetrahydronaphthalen-1-yl)ethyl]pyrrolo[1,2-a]pyrimidine-8-carboxamide (PubChem CID 121318306) has the molecular formula C22H25N3O and a molecular weight of 347.46 g/mol. Its IUPAC name is 2,4-dimethyl-N-[1-(5,6,7,8-tetrahydronaphthalen-1-yl)ethyl]pyrrolo[1,2-a]pyrimidine-8-carboxamide.
| Compound Name | 2,4-dimethyl-N-[1-(5,6,7,8-tetrahydronaphthalen-1-yl)ethyl]pyrrolo[1,2-a]pyrimidine-8-carboxamide |
|---|---|
| PubChem CID | 121318306 |
| Molecular Formula | C22H25N3O |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 2,4-dimethyl-N-[1-(5,6,7,8-tetrahydronaphthalen-1-yl)ethyl]pyrrolo[1,2-a]pyrimidine-8-carboxamide |
| SMILES | Cc1cc(C)n2ccc(C(=O)NC(C)c3cccc4c3CCCC4)c2n1 |
| InChI | InChI=1S/C22H25N3O/c1-14-13-15(2)25-12-11-20(21(25)23-14)22(26)24-16(3)18-10-6-8-17-7-4-5-9-19(17)18/h6,8,10-13,16H,4-5,7,9H2,1-3H3,(H,24,26) |
| InChIKey | VCQFJQPRZRMTIA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |