About methyl 5-amino-3-ethyl-1,2-dihydropyrazole-3-carboxylate
methyl 5-amino-3-ethyl-1,2-dihydropyrazole-3-carboxylate (PubChem CID 121319118) has the molecular formula C7H13N3O2
and a molecular weight of 171.20 g/mol. Its IUPAC name is methyl 5-amino-3-ethyl-1,2-dihydropyrazole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-amino-3-ethyl-1,2-dihydropyrazole-3-carboxylate |
| PubChem CID | 121319118 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | methyl 5-amino-3-ethyl-1,2-dihydropyrazole-3-carboxylate |
| SMILES | CCC1(C(=O)OC)C=C(N)NN1 |
| InChI | InChI=1S/C7H13N3O2/c1-3-7(6(11)12-2)4-5(8)9-10-7/h4,9-10H,3,8H2,1-2H3 |
| InChIKey | HQAIORCOZRQRGH-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-amino-3-ethyl-1,2-dihydropyrazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-amino-3-ethyl-1,2-dihydropyrazole-3-carboxylate?
The IUPAC name of methyl 5-amino-3-ethyl-1,2-dihydropyrazole-3-carboxylate (CID 121319118) is methyl 5-amino-3-ethyl-1,2-dihydropyrazole-3-carboxylate.
What is the SMILES notation for methyl 5-amino-3-ethyl-1,2-dihydropyrazole-3-carboxylate?
The canonical SMILES for methyl 5-amino-3-ethyl-1,2-dihydropyrazole-3-carboxylate is CCC1(C(=O)OC)C=C(N)NN1.
What is the InChIKey of methyl 5-amino-3-ethyl-1,2-dihydropyrazole-3-carboxylate?
The InChIKey is HQAIORCOZRQRGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O2/c1-3-7(6(11)12-2)4-5(8)9-10-7/h4,9-10H,3,8H2,1-2H3.
What are the key properties of methyl 5-amino-3-ethyl-1,2-dihydropyrazole-3-carboxylate?
methyl 5-amino-3-ethyl-1,2-dihydropyrazole-3-carboxylate has a molecular weight of 171.20 g/mol, XLogP of -0.78, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-amino-3-ethyl-1,2-dihydropyrazole-3-carboxylate is sourced from PubChem (CID 121319118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).