C19H19F2N5O3 — CID 121320011
N-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-5-methyl-7-(oxan-4-yl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (PubChem CID 121320011) has the molecular formula C19H19F2N5O3 and a molecular weight of 403.39 g/mol. Its IUPAC name is N-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-5-methyl-7-(oxan-4-yl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine.
| Compound Name | N-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-5-methyl-7-(oxan-4-yl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
|---|---|
| PubChem CID | 121320011 |
| Molecular Formula | C19H19F2N5O3 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | N-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]-5-methyl-7-(oxan-4-yl)-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| SMILES | Cc1cc(C2CCOCC2)n2nc(NCc3ccc4c(c3)OC(F)(F)O4)nc2n1 |
| InChI | InChI=1S/C19H19F2N5O3/c1-11-8-14(13-4-6-27-7-5-13)26-18(23-11)24-17(25-26)22-10-12-2-3-15-16(9-12)29-19(20,21)28-15/h2-3,8-9,13H,4-7,10H2,1H3,(H,22,25) |
| InChIKey | TZQMMYCMTHJMEV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 82.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |