C14H17ClN4O — CID 121320331
(4R)-10-chlorospiro[5-oxa-1,2,7,12-tetrazatricyclo[6.4.0.02,6]dodeca-6,8,10-triene-4,2'-bicyclo[2.2.2]octane] (PubChem CID 121320331) has the molecular formula C14H17ClN4O and a molecular weight of 292.77 g/mol. Its IUPAC name is (4R)-10-chlorospiro[5-oxa-1,2,7,12-tetrazatricyclo[6.4.0.02,6]dodeca-6,8,10-triene-4,2'-bicyclo[2.2.2]octane].
| Compound Name | (4R)-10-chlorospiro[5-oxa-1,2,7,12-tetrazatricyclo[6.4.0.02,6]dodeca-6,8,10-triene-4,2'-bicyclo[2.2.2]octane] |
|---|---|
| PubChem CID | 121320331 |
| Molecular Formula | C14H17ClN4O |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | (4R)-10-chlorospiro[5-oxa-1,2,7,12-tetrazatricyclo[6.4.0.02,6]dodeca-6,8,10-triene-4,2'-bicyclo[2.2.2]octane] |
| SMILES | ClC1=CNN2C(=C1)N=C1O[C@@]3(CC4CCC3CC4)CN12 |
| InChI | InChI=1S/C14H17ClN4O/c15-11-5-12-17-13-18(19(12)16-7-11)8-14(20-13)6-9-1-3-10(14)4-2-9/h5,7,9-10,16H,1-4,6,8H2/t9?,10?,14-/m0/s1 |
| InChIKey | MWYDESCHZYHDOK-FDZGAKKTSA-N |
| XLogP | 2.29 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |