About 5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]-7-(1H-pyrazol-5-yl)triazolo[4,5-d]pyrimidine
5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]-7-(1H-pyrazol-5-yl)triazolo[4,5-d]pyrimidine (PubChem CID 121320513) has the molecular formula C14H17N11
and a molecular weight of 339.37 g/mol. Its IUPAC name is 5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]-7-(1H-pyrazol-5-yl)triazolo[4,5-d]pyrimidine.
Molecular Properties
| Compound Name | 5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]-7-(1H-pyrazol-5-yl)triazolo[4,5-d]pyrimidine |
| PubChem CID | 121320513 |
| Molecular Formula | C14H17N11 |
| Molecular Weight | 339.37 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]-7-(1H-pyrazol-5-yl)triazolo[4,5-d]pyrimidine |
| SMILES | Cn1nnnc1Cn1nnc2c(-c3ccn[nH]3)nc(C(C)(C)C)nc21 |
| InChI | InChI=1S/C14H17N11/c1-14(2,3)13-16-10(8-5-6-15-18-8)11-12(17-13)25(22-20-11)7-9-19-21-23-24(9)4/h5-6H,7H2,1-4H3,(H,15,18) |
| InChIKey | RGRMWMNVIIZGJM-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 128.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.37 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Analyze 5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]-7-(1H-pyrazol-5-yl)triazolo[4,5-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]-7-(1H-pyrazol-5-yl)triazolo[4,5-d]pyrimidine?
The IUPAC name of 5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]-7-(1H-pyrazol-5-yl)triazolo[4,5-d]pyrimidine (CID 121320513) is 5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]-7-(1H-pyrazol-5-yl)triazolo[4,5-d]pyrimidine.
What is the SMILES notation for 5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]-7-(1H-pyrazol-5-yl)triazolo[4,5-d]pyrimidine?
The canonical SMILES for 5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]-7-(1H-pyrazol-5-yl)triazolo[4,5-d]pyrimidine is Cn1nnnc1Cn1nnc2c(-c3ccn[nH]3)nc(C(C)(C)C)nc21.
What is the InChIKey of 5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]-7-(1H-pyrazol-5-yl)triazolo[4,5-d]pyrimidine?
The InChIKey is RGRMWMNVIIZGJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N11/c1-14(2,3)13-16-10(8-5-6-15-18-8)11-12(17-13)25(22-20-11)7-9-19-21-23-24(9)4/h5-6H,7H2,1-4H3,(H,15,18).
What are the key properties of 5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]-7-(1H-pyrazol-5-yl)triazolo[4,5-d]pyrimidine?
5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]-7-(1H-pyrazol-5-yl)triazolo[4,5-d]pyrimidine has a molecular weight of 339.37 g/mol, XLogP of 0.48, 3 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-3-[(1-methyltetrazol-5-yl)methyl]-7-(1H-pyrazol-5-yl)triazolo[4,5-d]pyrimidine is sourced from PubChem (CID 121320513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).