C25H30N4O4S — CID 121321377
2-[amino-[2-(2-oxo-1-pyridinyl)acetyl]amino]-2-(4-methoxyphenyl)-N-[4-(trimethyl-λ4-sulfanyl)phenyl]acetamide (PubChem CID 121321377) has the molecular formula C25H30N4O4S and a molecular weight of 482.61 g/mol. Its IUPAC name is 2-[amino-[2-(2-oxo-1-pyridinyl)acetyl]amino]-2-(4-methoxyphenyl)-N-[4-(trimethyl-λ4-sulfanyl)phenyl]acetamide.
| Compound Name | 2-[amino-[2-(2-oxo-1-pyridinyl)acetyl]amino]-2-(4-methoxyphenyl)-N-[4-(trimethyl-λ4-sulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 121321377 |
| Molecular Formula | C25H30N4O4S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 2-[amino-[2-(2-oxo-1-pyridinyl)acetyl]amino]-2-(4-methoxyphenyl)-N-[4-(trimethyl-λ4-sulfanyl)phenyl]acetamide |
| SMILES | COc1ccc(C(C(=O)Nc2ccc(S(C)(C)C)cc2)N(N)C(=O)Cn2ccccc2=O)cc1 |
| InChI | InChI=1S/C25H30N4O4S/c1-33-20-12-8-18(9-13-20)24(29(26)23(31)17-28-16-6-5-7-22(28)30)25(32)27-19-10-14-21(15-11-19)34(2,3)4/h5-16,24H,17,26H2,1-4H3,(H,27,32) |
| InChIKey | MFVAWZZEFLVXEE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|