C35H47N7O — CID 121321978
[4-[6-amino-2-[[4-[(E)-7-(cyclohexylamino)hept-3-enyl]phenyl]methylamino]pyrimidin-4-yl]piperazin-1-yl]-phenylmethanone (PubChem CID 121321978) has the molecular formula C35H47N7O and a molecular weight of 581.81 g/mol. Its IUPAC name is [4-[6-amino-2-[[4-[(E)-7-(cyclohexylamino)hept-3-enyl]phenyl]methylamino]pyrimidin-4-yl]piperazin-1-yl]-phenylmethanone.
| Compound Name | [4-[6-amino-2-[[4-[(E)-7-(cyclohexylamino)hept-3-enyl]phenyl]methylamino]pyrimidin-4-yl]piperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 121321978 |
| Molecular Formula | C35H47N7O |
| Molecular Weight | 581.81 g/mol |
| Exact Mass | 581.38 |
| IUPAC Name | [4-[6-amino-2-[[4-[(E)-7-(cyclohexylamino)hept-3-enyl]phenyl]methylamino]pyrimidin-4-yl]piperazin-1-yl]-phenylmethanone |
| SMILES | Nc1cc(N2CCN(C(=O)c3ccccc3)CC2)nc(NCc2ccc(CC/C=C/CCCNC3CCCCC3)cc2)n1 |
| InChI | InChI=1S/C35H47N7O/c36-32-26-33(41-22-24-42(25-23-41)34(43)30-13-7-4-8-14-30)40-35(39-32)38-27-29-19-17-28(18-20-29)12-6-2-1-3-11-21-37-31-15-9-5-10-16-31/h1-2,4,7-8,13-14,17-20,26,31,37H,3,5-6,9-12,15-16,21-25,27H2,(H3,36,38,39,40)/b2-1+ |
| InChIKey | WRANTEGJFCNHQD-OWOJBTEDSA-N |
| XLogP | 5.82 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.81 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|