About 6-(4H-imidazol-4-yl)-1,2-dihydropyridine
6-(4H-imidazol-4-yl)-1,2-dihydropyridine (PubChem CID 121322291) has the molecular formula C8H9N3
and a molecular weight of 147.18 g/mol. Its IUPAC name is 6-(4H-imidazol-4-yl)-1,2-dihydropyridine.
Molecular Properties
| Compound Name | 6-(4H-imidazol-4-yl)-1,2-dihydropyridine |
| PubChem CID | 121322291 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 6-(4H-imidazol-4-yl)-1,2-dihydropyridine |
| SMILES | C1=CCNC(C2C=NC=N2)=C1 |
| InChI | InChI=1S/C8H9N3/c1-2-4-10-7(3-1)8-5-9-6-11-8/h1-3,5-6,8,10H,4H2 |
| InChIKey | INTVFFRDRPYPBE-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(4H-imidazol-4-yl)-1,2-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4H-imidazol-4-yl)-1,2-dihydropyridine?
The IUPAC name of 6-(4H-imidazol-4-yl)-1,2-dihydropyridine (CID 121322291) is 6-(4H-imidazol-4-yl)-1,2-dihydropyridine.
What is the SMILES notation for 6-(4H-imidazol-4-yl)-1,2-dihydropyridine?
The canonical SMILES for 6-(4H-imidazol-4-yl)-1,2-dihydropyridine is C1=CCNC(C2C=NC=N2)=C1.
What is the InChIKey of 6-(4H-imidazol-4-yl)-1,2-dihydropyridine?
The InChIKey is INTVFFRDRPYPBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3/c1-2-4-10-7(3-1)8-5-9-6-11-8/h1-3,5-6,8,10H,4H2.
What are the key properties of 6-(4H-imidazol-4-yl)-1,2-dihydropyridine?
6-(4H-imidazol-4-yl)-1,2-dihydropyridine has a molecular weight of 147.18 g/mol, XLogP of 0.51, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4H-imidazol-4-yl)-1,2-dihydropyridine is sourced from PubChem (CID 121322291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).