About butyl (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate
butyl (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate (PubChem CID 121322349) has the molecular formula C16H29NO4
and a molecular weight of 299.41 g/mol. Its IUPAC name is butyl (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate.
Molecular Properties
| Compound Name | butyl (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
| PubChem CID | 121322349 |
| Molecular Formula | C16H29NO4 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | butyl (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate |
| SMILES | C=CC(C)(C)[C@H](NC(=O)OC(C)(C)C)C(=O)OCCCC |
| InChI | InChI=1S/C16H29NO4/c1-8-10-11-20-13(18)12(16(6,7)9-2)17-14(19)21-15(3,4)5/h9,12H,2,8,10-11H2,1,3-7H3,(H,17,19)/t12-/m1/s1 |
| InChIKey | CMZHZCGKWDDSHB-GFCCVEGCSA-N |
| XLogP | 3.44 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze butyl (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate?
The IUPAC name of butyl (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate (CID 121322349) is butyl (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate.
What is the SMILES notation for butyl (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate?
The canonical SMILES for butyl (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate is C=CC(C)(C)[C@H](NC(=O)OC(C)(C)C)C(=O)OCCCC.
What is the InChIKey of butyl (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate?
The InChIKey is CMZHZCGKWDDSHB-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H29NO4/c1-8-10-11-20-13(18)12(16(6,7)9-2)17-14(19)21-15(3,4)5/h9,12H,2,8,10-11H2,1,3-7H3,(H,17,19)/t12-/m1/s1.
What are the key properties of butyl (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate?
butyl (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate has a molecular weight of 299.41 g/mol, XLogP of 3.44, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl (2S)-3,3-dimethyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoate is sourced from PubChem (CID 121322349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).