C32H38N8O3 — CID 121322819
1-[2-(2-methylidenehydrazinyl)-2-oxoethyl]-N-[(6-methyl-2-oxo-4-propyl-1H-pyridin-3-yl)methyl]-6-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]indole-4-carboxamide (PubChem CID 121322819) has the molecular formula C32H38N8O3 and a molecular weight of 582.71 g/mol. Its IUPAC name is 1-[2-(2-methylidenehydrazinyl)-2-oxoethyl]-N-[(6-methyl-2-oxo-4-propyl-1H-pyridin-3-yl)methyl]-6-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]indole-4-carboxamide.
| Compound Name | 1-[2-(2-methylidenehydrazinyl)-2-oxoethyl]-N-[(6-methyl-2-oxo-4-propyl-1H-pyridin-3-yl)methyl]-6-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]indole-4-carboxamide |
|---|---|
| PubChem CID | 121322819 |
| Molecular Formula | C32H38N8O3 |
| Molecular Weight | 582.71 g/mol |
| Exact Mass | 582.31 |
| IUPAC Name | 1-[2-(2-methylidenehydrazinyl)-2-oxoethyl]-N-[(6-methyl-2-oxo-4-propyl-1H-pyridin-3-yl)methyl]-6-[6-(4-methylpiperazin-1-yl)-3-pyridinyl]indole-4-carboxamide |
| SMILES | C=NNC(=O)Cn1ccc2c(C(=O)NCc3c(CCC)cc(C)[nH]c3=O)cc(-c3ccc(N4CCN(C)CC4)nc3)cc21 |
| InChI | InChI=1S/C32H38N8O3/c1-5-6-22-15-21(2)36-32(43)27(22)19-35-31(42)26-16-24(17-28-25(26)9-10-40(28)20-30(41)37-33-3)23-7-8-29(34-18-23)39-13-11-38(4)12-14-39/h7-10,15-18H,3,5-6,11-14,19-20H2,1-2,4H3,(H,35,42)(H,36,43)(H,37,41) |
| InChIKey | YSTXTLVGHQPYCV-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 127.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.71 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|