C30H42F2O2S2 — CID 121323760
2,6-ditert-butyl-4-[difluoro-[4-(5-pentyl-1,3-dithian-2-yl)phenyl]methoxy]phenol (PubChem CID 121323760) has the molecular formula C30H42F2O2S2 and a molecular weight of 536.79 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-[difluoro-[4-(5-pentyl-1,3-dithian-2-yl)phenyl]methoxy]phenol.
| Compound Name | 2,6-ditert-butyl-4-[difluoro-[4-(5-pentyl-1,3-dithian-2-yl)phenyl]methoxy]phenol |
|---|---|
| PubChem CID | 121323760 |
| Molecular Formula | C30H42F2O2S2 |
| Molecular Weight | 536.79 g/mol |
| Exact Mass | 536.26 |
| IUPAC Name | 2,6-ditert-butyl-4-[difluoro-[4-(5-pentyl-1,3-dithian-2-yl)phenyl]methoxy]phenol |
| SMILES | CCCCCC1CSC(c2ccc(C(F)(F)Oc3cc(C(C)(C)C)c(O)c(C(C)(C)C)c3)cc2)SC1 |
| InChI | InChI=1S/C30H42F2O2S2/c1-8-9-10-11-20-18-35-27(36-19-20)21-12-14-22(15-13-21)30(31,32)34-23-16-24(28(2,3)4)26(33)25(17-23)29(5,6)7/h12-17,20,27,33H,8-11,18-19H2,1-7H3 |
| InChIKey | OAAXUBYZWXIGBV-UHFFFAOYSA-N |
| XLogP | 9.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.79 |
| LogP ≤ 5 | 9.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|