C18H21F7O7 — CID 121323926
[2-[4-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-oxoethoxy]cyclohexyl]oxy-2-oxoethyl] 2-methylprop-2-enoate (PubChem CID 121323926) has the molecular formula C18H21F7O7 and a molecular weight of 482.35 g/mol. Its IUPAC name is [2-[4-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-oxoethoxy]cyclohexyl]oxy-2-oxoethyl] 2-methylprop-2-enoate.
| Compound Name | [2-[4-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-oxoethoxy]cyclohexyl]oxy-2-oxoethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 121323926 |
| Molecular Formula | C18H21F7O7 |
| Molecular Weight | 482.35 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | [2-[4-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-oxoethoxy]cyclohexyl]oxy-2-oxoethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)OC1CCC(OCC(=O)OCC(F)(F)C(F)(F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C18H21F7O7/c1-10(2)15(28)30-8-14(27)32-12-5-3-11(4-6-12)29-7-13(26)31-9-16(19,20)17(21,22)18(23,24)25/h11-12H,1,3-9H2,2H3 |
| InChIKey | HEVSFSOSUWHIHN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|