C25H27F3N2O5S — CID 121324454
[(Z)-[1-(1,3-benzoxazol-2-yl)-3,3,3-trifluoro-2-oxopropylidene]amino] 2,4,6-tri(propan-2-yl)benzenesulfonate (PubChem CID 121324454) has the molecular formula C25H27F3N2O5S and a molecular weight of 524.56 g/mol. Its IUPAC name is [(Z)-[1-(1,3-benzoxazol-2-yl)-3,3,3-trifluoro-2-oxopropylidene]amino] 2,4,6-tri(propan-2-yl)benzenesulfonate.
| Compound Name | [(Z)-[1-(1,3-benzoxazol-2-yl)-3,3,3-trifluoro-2-oxopropylidene]amino] 2,4,6-tri(propan-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 121324454 |
| Molecular Formula | C25H27F3N2O5S |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | [(Z)-[1-(1,3-benzoxazol-2-yl)-3,3,3-trifluoro-2-oxopropylidene]amino] 2,4,6-tri(propan-2-yl)benzenesulfonate |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)O/N=C(\C(=O)C(F)(F)F)c2nc3ccccc3o2)c(C(C)C)c1 |
| InChI | InChI=1S/C25H27F3N2O5S/c1-13(2)16-11-17(14(3)4)22(18(12-16)15(5)6)36(32,33)35-30-21(23(31)25(26,27)28)24-29-19-9-7-8-10-20(19)34-24/h7-15H,1-6H3/b30-21+ |
| InChIKey | JMLGSPOXUCCDIH-MWAVMZGNSA-N |
| XLogP | 6.44 |
| TPSA | 98.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|