C21H22F10O7 — CID 121325803
2-[4-[2-(2-methylprop-2-enoyloxy)acetyl]oxycyclohexyl]oxyethyl 2,2,3,3,4,4,5,5,6,6-decafluorocyclohexane-1-carboxylate (PubChem CID 121325803) has the molecular formula C21H22F10O7 and a molecular weight of 576.38 g/mol. Its IUPAC name is 2-[4-[2-(2-methylprop-2-enoyloxy)acetyl]oxycyclohexyl]oxyethyl 2,2,3,3,4,4,5,5,6,6-decafluorocyclohexane-1-carboxylate.
| Compound Name | 2-[4-[2-(2-methylprop-2-enoyloxy)acetyl]oxycyclohexyl]oxyethyl 2,2,3,3,4,4,5,5,6,6-decafluorocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 121325803 |
| Molecular Formula | C21H22F10O7 |
| Molecular Weight | 576.38 g/mol |
| Exact Mass | 576.12 |
| IUPAC Name | 2-[4-[2-(2-methylprop-2-enoyloxy)acetyl]oxycyclohexyl]oxyethyl 2,2,3,3,4,4,5,5,6,6-decafluorocyclohexane-1-carboxylate |
| SMILES | C=C(C)C(=O)OCC(=O)OC1CCC(OCCOC(=O)C2C(F)(F)C(F)(F)C(F)(F)C(F)(F)C2(F)F)CC1 |
| InChI | InChI=1S/C21H22F10O7/c1-10(2)15(33)37-9-13(32)38-12-5-3-11(4-6-12)35-7-8-36-16(34)14-17(22,23)19(26,27)21(30,31)20(28,29)18(14,24)25/h11-12,14H,1,3-9H2,2H3 |
| InChIKey | INSRSKGANAZSRE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|