C17H23ClN6O3 — CID 121325924
1-amino-8-(3-amino-5-chloro-2-methanimidoylphenyl)-3-(2-methoxyethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 121325924) has the molecular formula C17H23ClN6O3 and a molecular weight of 394.86 g/mol. Its IUPAC name is 1-amino-8-(3-amino-5-chloro-2-methanimidoylphenyl)-3-(2-methoxyethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 1-amino-8-(3-amino-5-chloro-2-methanimidoylphenyl)-3-(2-methoxyethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 121325924 |
| Molecular Formula | C17H23ClN6O3 |
| Molecular Weight | 394.86 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 1-amino-8-(3-amino-5-chloro-2-methanimidoylphenyl)-3-(2-methoxyethyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | [H]/N=C/c1c(N)cc(Cl)cc1N1CCC2(CC1)C(=O)N(CCOC)C(=O)N2N |
| InChI | InChI=1S/C17H23ClN6O3/c1-27-7-6-23-15(25)17(24(21)16(23)26)2-4-22(5-3-17)14-9-11(18)8-13(20)12(14)10-19/h8-10,19H,2-7,20-21H2,1H3/b19-10+ |
| InChIKey | MQRLGGWGWUEJOG-VXLYETTFSA-N |
| XLogP | 1.04 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.86 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|