About 2-(6-chloro-1H-indazol-4-yl)-3,4-dihydro-1H-2,6-naphthyridine
2-(6-chloro-1H-indazol-4-yl)-3,4-dihydro-1H-2,6-naphthyridine (PubChem CID 121326451) has the molecular formula C15H13ClN4
and a molecular weight of 284.75 g/mol. Its IUPAC name is 2-(6-chloro-1H-indazol-4-yl)-3,4-dihydro-1H-2,6-naphthyridine.
Molecular Properties
| Compound Name | 2-(6-chloro-1H-indazol-4-yl)-3,4-dihydro-1H-2,6-naphthyridine |
| PubChem CID | 121326451 |
| Molecular Formula | C15H13ClN4 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 2-(6-chloro-1H-indazol-4-yl)-3,4-dihydro-1H-2,6-naphthyridine |
| SMILES | Clc1cc(N2CCc3cnccc3C2)c2cn[nH]c2c1 |
| InChI | InChI=1S/C15H13ClN4/c16-12-5-14-13(8-18-19-14)15(6-12)20-4-2-10-7-17-3-1-11(10)9-20/h1,3,5-8H,2,4,9H2,(H,18,19) |
| InChIKey | GHUXSCOXLXQJLX-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6-chloro-1H-indazol-4-yl)-3,4-dihydro-1H-2,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-chloro-1H-indazol-4-yl)-3,4-dihydro-1H-2,6-naphthyridine?
The IUPAC name of 2-(6-chloro-1H-indazol-4-yl)-3,4-dihydro-1H-2,6-naphthyridine (CID 121326451) is 2-(6-chloro-1H-indazol-4-yl)-3,4-dihydro-1H-2,6-naphthyridine.
What is the SMILES notation for 2-(6-chloro-1H-indazol-4-yl)-3,4-dihydro-1H-2,6-naphthyridine?
The canonical SMILES for 2-(6-chloro-1H-indazol-4-yl)-3,4-dihydro-1H-2,6-naphthyridine is Clc1cc(N2CCc3cnccc3C2)c2cn[nH]c2c1.
What is the InChIKey of 2-(6-chloro-1H-indazol-4-yl)-3,4-dihydro-1H-2,6-naphthyridine?
The InChIKey is GHUXSCOXLXQJLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13ClN4/c16-12-5-14-13(8-18-19-14)15(6-12)20-4-2-10-7-17-3-1-11(10)9-20/h1,3,5-8H,2,4,9H2,(H,18,19).
What are the key properties of 2-(6-chloro-1H-indazol-4-yl)-3,4-dihydro-1H-2,6-naphthyridine?
2-(6-chloro-1H-indazol-4-yl)-3,4-dihydro-1H-2,6-naphthyridine has a molecular weight of 284.75 g/mol, XLogP of 3.17, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chloro-1H-indazol-4-yl)-3,4-dihydro-1H-2,6-naphthyridine is sourced from PubChem (CID 121326451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).