C19H20ClN7O2 — CID 121326720
8-(6-chloro-1H-indazol-4-yl)-3-[(1-methylimidazol-2-yl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 121326720) has the molecular formula C19H20ClN7O2 and a molecular weight of 413.87 g/mol. Its IUPAC name is 8-(6-chloro-1H-indazol-4-yl)-3-[(1-methylimidazol-2-yl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(6-chloro-1H-indazol-4-yl)-3-[(1-methylimidazol-2-yl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 121326720 |
| Molecular Formula | C19H20ClN7O2 |
| Molecular Weight | 413.87 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 8-(6-chloro-1H-indazol-4-yl)-3-[(1-methylimidazol-2-yl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | Cn1ccnc1CN1C(=O)NC2(CCN(c3cc(Cl)cc4[nH]ncc34)CC2)C1=O |
| InChI | InChI=1S/C19H20ClN7O2/c1-25-7-4-21-16(25)11-27-17(28)19(23-18(27)29)2-5-26(6-3-19)15-9-12(20)8-14-13(15)10-22-24-14/h4,7-10H,2-3,5-6,11H2,1H3,(H,22,24)(H,23,29) |
| InChIKey | KDSXQHDTWAGBSW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 99.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.87 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|