C14H16ClN5O2 — CID 121326921
8-(3-amino-5-chloro-2-methanimidoylphenyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 121326921) has the molecular formula C14H16ClN5O2 and a molecular weight of 321.77 g/mol. Its IUPAC name is 8-(3-amino-5-chloro-2-methanimidoylphenyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(3-amino-5-chloro-2-methanimidoylphenyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 121326921 |
| Molecular Formula | C14H16ClN5O2 |
| Molecular Weight | 321.77 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | 8-(3-amino-5-chloro-2-methanimidoylphenyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | [H]/N=C/c1c(N)cc(Cl)cc1N1CCC2(CC1)NC(=O)NC2=O |
| InChI | InChI=1S/C14H16ClN5O2/c15-8-5-10(17)9(7-16)11(6-8)20-3-1-14(2-4-20)12(21)18-13(22)19-14/h5-7,16H,1-4,17H2,(H2,18,19,21,22)/b16-7+ |
| InChIKey | ORTPCAMQKKAPBX-FRKPEAEDSA-N |
| XLogP | 1.10 |
| TPSA | 111.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.77 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|