About [4-(4-cyano-3,5-difluorophenyl)phenyl] formate
[4-(4-cyano-3,5-difluorophenyl)phenyl] formate (PubChem CID 121327810) has the molecular formula C14H7F2NO2
and a molecular weight of 259.21 g/mol. Its IUPAC name is [4-(4-cyano-3,5-difluorophenyl)phenyl] formate.
Molecular Properties
| Compound Name | [4-(4-cyano-3,5-difluorophenyl)phenyl] formate |
| PubChem CID | 121327810 |
| Molecular Formula | C14H7F2NO2 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | [4-(4-cyano-3,5-difluorophenyl)phenyl] formate |
| SMILES | N#Cc1c(F)cc(-c2ccc(OC=O)cc2)cc1F |
| InChI | InChI=1S/C14H7F2NO2/c15-13-5-10(6-14(16)12(13)7-17)9-1-3-11(4-2-9)19-8-18/h1-6,8H |
| InChIKey | CCJNHFFBPOBGNO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-cyano-3,5-difluorophenyl)phenyl] formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-cyano-3,5-difluorophenyl)phenyl] formate?
The IUPAC name of [4-(4-cyano-3,5-difluorophenyl)phenyl] formate (CID 121327810) is [4-(4-cyano-3,5-difluorophenyl)phenyl] formate.
What is the SMILES notation for [4-(4-cyano-3,5-difluorophenyl)phenyl] formate?
The canonical SMILES for [4-(4-cyano-3,5-difluorophenyl)phenyl] formate is N#Cc1c(F)cc(-c2ccc(OC=O)cc2)cc1F.
What is the InChIKey of [4-(4-cyano-3,5-difluorophenyl)phenyl] formate?
The InChIKey is CCJNHFFBPOBGNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H7F2NO2/c15-13-5-10(6-14(16)12(13)7-17)9-1-3-11(4-2-9)19-8-18/h1-6,8H.
What are the key properties of [4-(4-cyano-3,5-difluorophenyl)phenyl] formate?
[4-(4-cyano-3,5-difluorophenyl)phenyl] formate has a molecular weight of 259.21 g/mol, XLogP of 3.04, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-cyano-3,5-difluorophenyl)phenyl] formate is sourced from PubChem (CID 121327810), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).