About (2,4-dimethylimidazo[1,5-a]pyrimidin-8-yl)methanol
(2,4-dimethylimidazo[1,5-a]pyrimidin-8-yl)methanol (PubChem CID 121328441) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is (2,4-dimethylimidazo[1,5-a]pyrimidin-8-yl)methanol.
Molecular Properties
| Compound Name | (2,4-dimethylimidazo[1,5-a]pyrimidin-8-yl)methanol |
| PubChem CID | 121328441 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | (2,4-dimethylimidazo[1,5-a]pyrimidin-8-yl)methanol |
| SMILES | Cc1cc(C)n2cnc(CO)c2n1 |
| InChI | InChI=1S/C9H11N3O/c1-6-3-7(2)12-5-10-8(4-13)9(12)11-6/h3,5,13H,4H2,1-2H3 |
| InChIKey | LAAMGUDUIRTFNY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2,4-dimethylimidazo[1,5-a]pyrimidin-8-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dimethylimidazo[1,5-a]pyrimidin-8-yl)methanol?
The IUPAC name of (2,4-dimethylimidazo[1,5-a]pyrimidin-8-yl)methanol (CID 121328441) is (2,4-dimethylimidazo[1,5-a]pyrimidin-8-yl)methanol.
What is the SMILES notation for (2,4-dimethylimidazo[1,5-a]pyrimidin-8-yl)methanol?
The canonical SMILES for (2,4-dimethylimidazo[1,5-a]pyrimidin-8-yl)methanol is Cc1cc(C)n2cnc(CO)c2n1.
What is the InChIKey of (2,4-dimethylimidazo[1,5-a]pyrimidin-8-yl)methanol?
The InChIKey is LAAMGUDUIRTFNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O/c1-6-3-7(2)12-5-10-8(4-13)9(12)11-6/h3,5,13H,4H2,1-2H3.
What are the key properties of (2,4-dimethylimidazo[1,5-a]pyrimidin-8-yl)methanol?
(2,4-dimethylimidazo[1,5-a]pyrimidin-8-yl)methanol has a molecular weight of 177.21 g/mol, XLogP of 0.84, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dimethylimidazo[1,5-a]pyrimidin-8-yl)methanol is sourced from PubChem (CID 121328441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).