About N-propan-2-yl-2-[(2,4,6-trimethyl-2H-pyrimidin-1-yl)methylideneamino]acetamide
N-propan-2-yl-2-[(2,4,6-trimethyl-2H-pyrimidin-1-yl)methylideneamino]acetamide (PubChem CID 121328444) has the molecular formula C13H22N4O
and a molecular weight of 250.35 g/mol. Its IUPAC name is N-propan-2-yl-2-[(2,4,6-trimethyl-2H-pyrimidin-1-yl)methylideneamino]acetamide.
Molecular Properties
| Compound Name | N-propan-2-yl-2-[(2,4,6-trimethyl-2H-pyrimidin-1-yl)methylideneamino]acetamide |
| PubChem CID | 121328444 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | N-propan-2-yl-2-[(2,4,6-trimethyl-2H-pyrimidin-1-yl)methylideneamino]acetamide |
| SMILES | CC1=CC(C)=NC(C)N1/C=N/CC(=O)NC(C)C |
| InChI | InChI=1S/C13H22N4O/c1-9(2)15-13(18)7-14-8-17-11(4)6-10(3)16-12(17)5/h6,8-9,12H,7H2,1-5H3,(H,15,18)/b14-8+ |
| InChIKey | GYOSPAJAFRMKAI-RIYZIHGNSA-N |
| XLogP | 1.57 |
| TPSA | 57.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-propan-2-yl-2-[(2,4,6-trimethyl-2H-pyrimidin-1-yl)methylideneamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-yl-2-[(2,4,6-trimethyl-2H-pyrimidin-1-yl)methylideneamino]acetamide?
The IUPAC name of N-propan-2-yl-2-[(2,4,6-trimethyl-2H-pyrimidin-1-yl)methylideneamino]acetamide (CID 121328444) is N-propan-2-yl-2-[(2,4,6-trimethyl-2H-pyrimidin-1-yl)methylideneamino]acetamide.
What is the SMILES notation for N-propan-2-yl-2-[(2,4,6-trimethyl-2H-pyrimidin-1-yl)methylideneamino]acetamide?
The canonical SMILES for N-propan-2-yl-2-[(2,4,6-trimethyl-2H-pyrimidin-1-yl)methylideneamino]acetamide is CC1=CC(C)=NC(C)N1/C=N/CC(=O)NC(C)C.
What is the InChIKey of N-propan-2-yl-2-[(2,4,6-trimethyl-2H-pyrimidin-1-yl)methylideneamino]acetamide?
The InChIKey is GYOSPAJAFRMKAI-RIYZIHGNSA-N. The full InChI is InChI=1S/C13H22N4O/c1-9(2)15-13(18)7-14-8-17-11(4)6-10(3)16-12(17)5/h6,8-9,12H,7H2,1-5H3,(H,15,18)/b14-8+.
What are the key properties of N-propan-2-yl-2-[(2,4,6-trimethyl-2H-pyrimidin-1-yl)methylideneamino]acetamide?
N-propan-2-yl-2-[(2,4,6-trimethyl-2H-pyrimidin-1-yl)methylideneamino]acetamide has a molecular weight of 250.35 g/mol, XLogP of 1.57, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-yl-2-[(2,4,6-trimethyl-2H-pyrimidin-1-yl)methylideneamino]acetamide is sourced from PubChem (CID 121328444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).