C8H12N2 — CID 121329199
(2Z)-5,6-dimethyl-6,7-dihydro-1,4-diazocine (PubChem CID 121329199) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is (2Z)-5,6-dimethyl-6,7-dihydro-1,4-diazocine.
| Compound Name | (2Z)-5,6-dimethyl-6,7-dihydro-1,4-diazocine |
|---|---|
| PubChem CID | 121329199 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | (2Z)-5,6-dimethyl-6,7-dihydro-1,4-diazocine |
| SMILES | C/C1=N/C=C\N=C/CC1C |
| InChI | InChI=1S/C8H12N2/c1-7-3-4-9-5-6-10-8(7)2/h4-7H,3H2,1-2H3/b6-5-,9-4-,10-8- |
| InChIKey | WZNMWYDAFNLQOG-HRYSVZNGSA-N |
| XLogP | 2.03 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |