C17H20ClN5 — CID 121329341
7-chloro-5-methyl-N-[[(1E,8Z)-7-methylidenecyclonona-1,8-dien-1-yl]methyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (PubChem CID 121329341) has the molecular formula C17H20ClN5 and a molecular weight of 329.84 g/mol. Its IUPAC name is 7-chloro-5-methyl-N-[[(1E,8Z)-7-methylidenecyclonona-1,8-dien-1-yl]methyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine.
| Compound Name | 7-chloro-5-methyl-N-[[(1E,8Z)-7-methylidenecyclonona-1,8-dien-1-yl]methyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
|---|---|
| PubChem CID | 121329341 |
| Molecular Formula | C17H20ClN5 |
| Molecular Weight | 329.84 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 7-chloro-5-methyl-N-[[(1E,8Z)-7-methylidenecyclonona-1,8-dien-1-yl]methyl]-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| SMILES | C=C1/C=C\C(CNc2nc3nc(C)cc(Cl)n3n2)=C/CCCC1 |
| InChI | InChI=1S/C17H20ClN5/c1-12-6-4-3-5-7-14(9-8-12)11-19-16-21-17-20-13(2)10-15(18)23(17)22-16/h7-10H,1,3-6,11H2,2H3,(H,19,22)/b9-8-,14-7+ |
| InChIKey | FCHPBDLAJXDAOY-GBYAIJDDSA-N |
| XLogP | 4.11 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.84 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |