About 1-ethenyl-4,6-dimethyl-2H-pyrimidine
1-ethenyl-4,6-dimethyl-2H-pyrimidine (PubChem CID 121329488) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 1-ethenyl-4,6-dimethyl-2H-pyrimidine.
Molecular Properties
| Compound Name | 1-ethenyl-4,6-dimethyl-2H-pyrimidine |
| PubChem CID | 121329488 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 1-ethenyl-4,6-dimethyl-2H-pyrimidine |
| SMILES | C=CN1CN=C(C)C=C1C |
| InChI | InChI=1S/C8H12N2/c1-4-10-6-9-7(2)5-8(10)3/h4-5H,1,6H2,2-3H3 |
| InChIKey | ZZNBANHMCSUBGJ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-ethenyl-4,6-dimethyl-2H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenyl-4,6-dimethyl-2H-pyrimidine?
The IUPAC name of 1-ethenyl-4,6-dimethyl-2H-pyrimidine (CID 121329488) is 1-ethenyl-4,6-dimethyl-2H-pyrimidine.
What is the SMILES notation for 1-ethenyl-4,6-dimethyl-2H-pyrimidine?
The canonical SMILES for 1-ethenyl-4,6-dimethyl-2H-pyrimidine is C=CN1CN=C(C)C=C1C.
What is the InChIKey of 1-ethenyl-4,6-dimethyl-2H-pyrimidine?
The InChIKey is ZZNBANHMCSUBGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-4-10-6-9-7(2)5-8(10)3/h4-5H,1,6H2,2-3H3.
What are the key properties of 1-ethenyl-4,6-dimethyl-2H-pyrimidine?
1-ethenyl-4,6-dimethyl-2H-pyrimidine has a molecular weight of 136.20 g/mol, XLogP of 1.77, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-4,6-dimethyl-2H-pyrimidine is sourced from PubChem (CID 121329488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).