About (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)but-3-en-1-amine
(2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)but-3-en-1-amine (PubChem CID 121329495) has the molecular formula C10H15N3
and a molecular weight of 177.25 g/mol. Its IUPAC name is (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)but-3-en-1-amine.
Molecular Properties
| Compound Name | (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)but-3-en-1-amine |
| PubChem CID | 121329495 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)but-3-en-1-amine |
| SMILES | C=C/C(CN)=C1/N=C(C)C=C(C)N1 |
| InChI | InChI=1S/C10H15N3/c1-4-9(6-11)10-12-7(2)5-8(3)13-10/h4-5,12H,1,6,11H2,2-3H3/b10-9- |
| InChIKey | BJGLVGQVWYLHCK-KTKRTIGZSA-N |
| XLogP | 1.31 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)but-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)but-3-en-1-amine?
The IUPAC name of (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)but-3-en-1-amine (CID 121329495) is (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)but-3-en-1-amine.
What is the SMILES notation for (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)but-3-en-1-amine?
The canonical SMILES for (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)but-3-en-1-amine is C=C/C(CN)=C1/N=C(C)C=C(C)N1.
What is the InChIKey of (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)but-3-en-1-amine?
The InChIKey is BJGLVGQVWYLHCK-KTKRTIGZSA-N. The full InChI is InChI=1S/C10H15N3/c1-4-9(6-11)10-12-7(2)5-8(3)13-10/h4-5,12H,1,6,11H2,2-3H3/b10-9-.
What are the key properties of (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)but-3-en-1-amine?
(2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)but-3-en-1-amine has a molecular weight of 177.25 g/mol, XLogP of 1.31, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-(4,6-dimethyl-1H-pyrimidin-2-ylidene)but-3-en-1-amine is sourced from PubChem (CID 121329495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).